Difference between revisions of "L-ARABITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Chlorides Chlorides] == * common name: ** an organochlorine compound * Synonym(s): ** RCl ** an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARABITOL L-ARABITOL] == * smiles: ** C(C(C(C(CO)O)O)O)O * common name: ** L-arabitol * inchi...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ARABITOL L-ARABITOL] == |
| + | * smiles: | ||
| + | ** C(C(C(C(CO)O)O)O)O | ||
* common name: | * common name: | ||
| − | ** | + | ** L-arabitol |
| + | * inchi key: | ||
| + | ** InChIKey=HEBKCHPVOIAQTA-IMJSIDKUSA-N | ||
| + | * molecular weight: | ||
| + | ** 152.147 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** arabitol |
| − | ** | + | ** arabinitol |
| + | ** 1,2,3,4,5-pentanepentol | ||
| + | ** L-arabinol | ||
| + | ** L-arabinitol | ||
| + | ** L-lyxitol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-14102]] | ||
| + | * [[RXN-8772]] | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 7643-75-6 |
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439255 439255] |
| + | * HMDB : HMDB01851 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00532 C00532] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.388391.html 388391] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18403 18403] | ||
| + | * METABOLIGHTS : MTBLC18403 | ||
| + | {{#set: smiles=C(C(C(C(CO)O)O)O)O}} | ||
| + | {{#set: common name=L-arabitol}} | ||
| + | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-IMJSIDKUSA-N}} | ||
| + | {{#set: molecular weight=152.147 }} | ||
| + | {{#set: common name=arabitol|arabinitol|1,2,3,4,5-pentanepentol|L-arabinol|L-arabinitol|L-lyxitol}} | ||
| + | {{#set: reversible reaction associated=RXN-14102|RXN-8772}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite L-ARABITOL
- smiles:
- C(C(C(C(CO)O)O)O)O
- common name:
- L-arabitol
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-IMJSIDKUSA-N
- molecular weight:
- 152.147
- Synonym(s):
- arabitol
- arabinitol
- 1,2,3,4,5-pentanepentol
- L-arabinol
- L-arabinitol
- L-lyxitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 7643-75-6
- PUBCHEM:
- HMDB : HMDB01851
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC18403
