Difference between revisions of "CPD-19202"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] == * smiles: ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(N...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19202 CPD-19202] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine |
| + | * inchi key: | ||
| + | ** InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 709.734 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG |
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-17832]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: smiles=C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)}} | |
| − | + | {{#set: common name=L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine}} | |
| − | + | {{#set: inchi key=InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O}} | |
| − | + | {{#set: molecular weight=709.734 }} | |
| − | + | {{#set: common name=L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG}} | |
| − | + | {{#set: consumed by=RXN-17832}} | |
| − | + | ||
| − | {{#set: smiles= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-19202
- smiles:
- C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)
- common name:
- L-4-hydroxyphenylglycine-L-arginyl-D-4-hydroxyphenylglycine-L-seryl-L 4-hydroxyphenylglycine
- inchi key:
- InChIKey=ZHBGOAMEFNAJGS-JUCVYKANSA-O
- molecular weight:
- 709.734
- Synonym(s):
- L-pHPG-L-Arg-D-pHPG-L-Ser-L-pHPG
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(N)=[N+])CCC(NC(=O)C([N+])C1(C=CC(O)=CC=1))C(=O)NC(C(NC(CO)C(=O)NC(C([O-])=O)C2(C=CC(O)=CC=2))=O)C3(C=CC(O)=CC=3)" cannot be used as a page name in this wiki.
