Difference between revisions of "CPD-718"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15448 RXN-15448] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15448 RXN-15448] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* common name:
 +
** 3-dehydroteasterone
 +
* inchi key:
 +
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
 +
* molecular weight:
 +
** 446.669   
 
* Synonym(s):
 
* Synonym(s):
 +
** dehydroteasterone
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[Light]][c] '''+''' 4.0 [[PROTON]][e] '''+''' 2.0 [[WATER]][c] '''+''' 2.0 [[PLASTOQUINONE]][c] '''=>''' 2.0 [[Plastoquinols]][c] '''+''' 1.0 [[OXYGEN-MOLECULE]][c] '''+''' 4.0 [[PROTON]][c]
+
* [[RXN-717]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 hν[c] '''+''' 4.0 H+[e] '''+''' 2.0 H2O[c] '''+''' 2.0 a plastoquinone[c] '''=>''' 2.0 a plastoquinol[c] '''+''' 1.0 oxygen[c] '''+''' 4.0 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_13951]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: gene associated=Tiso_gene_13951}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
−
{{#set: in pathway=}}
+
* CHEBI:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
 +
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=3-dehydroteasterone}}
 +
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
 +
{{#set: molecular weight=446.669    }}
 +
{{#set: common name=dehydroteasterone}}
 +
{{#set: produced by=RXN-717}}

Latest revision as of 19:59, 21 March 2018

Metabolite CPD-718

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 3-dehydroteasterone
  • inchi key:
    • InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
  • molecular weight:
    • 446.669
  • Synonym(s):
    • dehydroteasterone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-718&oldid=45082"