Difference between revisions of "RXN-22"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == * direction: ** LEFT-TO-RIGHT * common name: ** argininosuccinate_lyase * ec numb...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** argininosuccinate_lyase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/4.3.2.1 EC-4.3.2.1] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | == | + | * With identifiers: |
| − | * [[ | + | ** 1 [[CANAVANINOSUCCINATE]][c] '''=>''' 1 [[CANAVANINE]][c] '''+''' 1 [[FUM]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 canavaninosuccinate[c] '''=>''' 1 L-canavanine[c] '''+''' 1 fumarate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_2485]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: EC-NUMBER | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5] | ||
| + | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=argininosuccinate_lyase}} | |
| − | + | {{#set: ec number=EC-4.3.2.1}} | |
| − | {{#set: | + | {{#set: gene associated=Tiso_gene_2485}} |
| − | {{#set: | + | {{#set: in pathway=PWY-5}} |
| − | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
| − | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:59, 21 March 2018
Contents
Reaction RXN-22
- direction:
- LEFT-TO-RIGHT
- common name:
- argininosuccinate_lyase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CANAVANINOSUCCINATE[c] => 1 CANAVANINE[c] + 1 FUM[c]
- With common name(s):
- 1 canavaninosuccinate[c] => 1 L-canavanine[c] + 1 fumarate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2485
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
