Difference between revisions of "Tiso gene 17058"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_17058 == * right end position: ** 3904 * transcription direction: ** POSITIVE * left end position: ** 1133 * centisome position: ** 28.7198...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17385 CPD-17385] ==
+
== Gene Tiso_gene_17058 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** 3904
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA
+
** 1133
−
* molecular weight:
+
* centisome position:
−
** 1102.034    
+
** 28.719898    
 
* Synonym(s):
 
* Synonym(s):
−
** tetracosahexaenoyl-CoA
 
−
** all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA
 
−
** (6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-16134]]
+
* Reaction: [[GLUTAMIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-16132]]
+
*** Assignment: automated-name-match
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[GLUTAMINDEG-PWY]]
 +
* [[CITRULBIO-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3904}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581194 71581194]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=1133}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74086 74086]
+
{{#set: centisome position=28.719898   }}
−
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reaction associated=GLUTAMIN-RXN}}
−
{{#set: inchi key=InChIKey=KRIFZIRXAAITHR-KWFBMMABSA-J}}
+
{{#set: pathway associated=GLUTAMINDEG-PWY|CITRULBIO-PWY}}
−
{{#set: common name=(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosahexaenoyl-CoA}}
+
−
{{#set: molecular weight=1102.034   }}
+
−
{{#set: common name=tetracosahexaenoyl-CoA|all-cis6,-9,12,15,18,21-tetracosahexaenoyl-CoA|(6Z,9Z,12Z,15Z,18Z,21Z)-tetracosa-6,9,12,15,18,21-hexaenoyl-CoA}}
+
−
{{#set: consumed by=RXN-16134}}
+
−
{{#set: produced by=RXN-16132}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_17058

  • right end position:
    • 3904
  • transcription direction:
    • POSITIVE
  • left end position:
    • 1133
  • centisome position:
    • 28.719898
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_17058&oldid=45124"