Difference between revisions of "PROLINE-RACEMASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] == * smiles: ** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] == * direction: ** REVERSIBLE * common name: ** proline_...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2743 CPD-2743] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=PROLINE-RACEMASE-RXN PROLINE-RACEMASE-RXN] ==
* smiles:
+
* direction:
** C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N
+
 
* common name:
 
* common name:
** nicotine-1'-N-oxide
+
** proline_racemase
* molecular weight:
+
* ec number:
** 178.233   
+
** [http://enzyme.expasy.org/EC/5.1.1.4 EC-5.1.1.4]
 
* Synonym(s):
 
* Synonym(s):
** nicotine N'-oxide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN66-81]]
+
** 1 [[PRO]][c] '''<=>''' 1 [[D-PROLINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-proline[c] '''<=>''' 1 D-proline[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13061]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6344]], L-ornithine degradation II (Stickland reaction): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6344 PWY-6344]
 +
** '''4''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=68107 68107]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10680 10680]
* CHEMSPIDER:
+
* LIGAND-RXN:
** [http://www.chemspider.com/Chemical-Structure.61415.html 61415]
+
** [http://www.genome.jp/dbget-bin/www_bget?R01255 R01255]
* HMDB : HMDB01497
+
{{#set: direction=REVERSIBLE}}
{{#set: smiles=C1(CC[CH](N(=O)(C)1)C2(=CN=CC=C2))}}
+
{{#set: common name=proline_racemase}}
{{#set: inchi key=InChIKey=RWFBQHICRCUQJJ-NUHJPDEHSA-N}}
+
{{#set: ec number=EC-5.1.1.4}}
{{#set: common name=nicotine-1'-N-oxide}}
+
{{#set: gene associated=Tiso_gene_13061}}
{{#set: molecular weight=178.233    }}
+
{{#set: in pathway=PWY-6344}}
{{#set: common name=nicotine N'-oxide}}
+
{{#set: reconstruction category=annotation}}
{{#set: produced by=RXN66-81}}
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:00, 21 March 2018

Reaction PROLINE-RACEMASE-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • proline_racemase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-proline[c] <=> 1 D-proline[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6344, L-ornithine degradation II (Stickland reaction): PWY-6344
    • 4 reactions found over 9 reactions in the full pathway

Reconstruction information

External links