Difference between revisions of "RXN-17859"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17859 RXN-17859] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DGTP DGTP] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17859 RXN-17859] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J
+
** [http://enzyme.expasy.org/EC/2.3.1.bu EC-2.3.1.bu]
* common name:
+
** dGTP
+
* molecular weight:
+
** 503.152   
+
 
* Synonym(s):
 
* Synonym(s):
** 2'-deoxyguanosine-5'-triphosphate
 
** deoxy-GTP
 
** deoxyguanosine-triphosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[DGTCY]]
+
* With identifiers:
* [[DGTUP]]
+
** 1 [[N-terminal-L-valine]][c] '''+''' 1 [[ACETYL-COA]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[N-Ac-N-terminal-L-valine]][c] '''+''' 1 [[PROTON]][c]
* [[RXN0-385]]
+
* With common name(s):
* [[RME255]]
+
** 1 an N-terminal L-valyl-[protein][c] '''+''' 1 acetyl-CoA[c] '''=>''' 1 coenzyme A[c] '''+''' 1 an N-terminal Nα-acetyl-L-valyl-[protein][c] '''+''' 1 H+[c]
* [[RXN-11410]]
+
 
* [[RXN-14208]]
+
== Genes associated with this reaction  ==
* [[RXN-14217]]
+
== Pathways  ==
* [[DGTD]]
+
* [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800]
== Reaction(s) known to produce the compound ==
+
** '''21''' reactions found over '''21''' reactions in the full pathway
* [[ATDGD]]
+
== Reconstruction information  ==
* [[DGDPKIN-RXN]]
+
* Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
* [[RXN-14207]]
+
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 2564-35-4
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.bu}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246112 25246112]
+
{{#set: in pathway=PWY-7800}}
* HMDB : HMDB01440
+
{{#set: reconstruction category=annotation}}
* LIGAND-CPD:
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00286 C00286]
+
{{#set: reconstruction tool=pathwaytools}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61429 61429]
+
* BIGG : dgtp
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: inchi key=InChIKey=HAAZLUGHYHWQIW-KVQBGUIXSA-J}}
+
{{#set: common name=dGTP}}
+
{{#set: molecular weight=503.152    }}
+
{{#set: common name=2'-deoxyguanosine-5'-triphosphate|deoxy-GTP|deoxyguanosine-triphosphate}}
+
{{#set: consumed by=DGTCY|DGTUP|RXN0-385|RME255|RXN-11410|RXN-14208|RXN-14217|DGTD}}
+
{{#set: produced by=ATDGD|DGDPKIN-RXN}}
+
{{#set: consumed or produced by=RXN-14207}}
+

Latest revision as of 20:00, 21 March 2018

Reaction RXN-17859

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7800, Ac/N-end rule pathway: PWY-7800
    • 21 reactions found over 21 reactions in the full pathway

Reconstruction information

External links