Difference between revisions of "CPD1F-97"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7673 RXN-7673] == * direction: ** REVERSIBLE * common name: ** chlorophyll_chloroplastic * ec n...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7673 RXN-7673] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-97 CPD1F-97] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
 
* common name:
 
* common name:
−
** chlorophyll_chloroplastic
+
** gibberellin A15 (open lactone form)
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.5.1.62 EC-2.5.1.62]
+
** InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
 +
* molecular weight:
 +
** 346.422   
 
* Synonym(s):
 
* Synonym(s):
 +
** gibberellin A15
 +
** GA15
 +
** GA15 (open lactone form)
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN1F-163]]
−
** 1 [[GERANYLGERANYL-PP]][c] '''+''' 1 [[CPD-7014]][c] '''+''' 2 [[PROTON]][c] '''<=>''' 1 [[CPD-7013]][c] '''+''' 1 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN1F-162]]
−
** 1 geranylgeranyl diphosphate[c] '''+''' 1 chlorophyllide b[c] '''+''' 2 H+[c] '''<=>''' 1 geranylgeranyl chlorophyll b[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_19542]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* LIPID_MAPS : LMPR0104170017
−
{{#set: common name=chlorophyll_chloroplastic}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.5.1.62}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245948 25245948]
−
{{#set: gene associated=Tiso_gene_19542}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29590 29590]
−
{{#set: reconstruction category=annotation}}
+
* LIGAND-CPD:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11860 C11860]
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
 +
{{#set: common name=gibberellin A15 (open lactone form)}}
 +
{{#set: inchi key=InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L}}
 +
{{#set: molecular weight=346.422    }}
 +
{{#set: common name=gibberellin A15|GA15|GA15 (open lactone form)}}
 +
{{#set: consumed by=RXN1F-163}}
 +
{{#set: produced by=RXN1F-162}}

Latest revision as of 19:10, 21 March 2018

Metabolite CPD1F-97

  • smiles:
    • C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
  • common name:
    • gibberellin A15 (open lactone form)
  • inchi key:
    • InChIKey=TZGXVFYTKTWKCU-CXXOJBQZSA-L
  • molecular weight:
    • 346.422
  • Synonym(s):
    • gibberellin A15
    • GA15
    • GA15 (open lactone form)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(CO)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD1F-97&oldid=39881"