Difference between revisions of "HISTIDPHOS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-CIT HOMO-CIT] == * smiles: ** C(C([O-])=O)CC(O)(C([O-])=O)CC([O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTIDPHOS-RXN HISTIDPHOS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** histidinol-phosph...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HISTIDPHOS-RXN HISTIDPHOS-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** histidinol-phosphatase, chloroplast |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.1.3.15 EC-3.1.3.15] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[L-HISTIDINOL-P]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HISTIDINOL]][c] '''+''' 1 [[Pi]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 L-histidinol-phosphate[c] '''+''' 1 H2O[c] '''=>''' 1 histidinol[c] '''+''' 1 phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14713]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[HISTSYN-PWY]], L-histidine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=HISTSYN-PWY HISTSYN-PWY] | ||
+ | ** '''10''' reactions found over '''10''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | * | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14465 14465] |
− | ** [http:// | + | * PIR: |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=D70002 D70002] |
− | * LIGAND- | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DWEBHB DWEBHB] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=DWECHB DWECHB] |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=E81255 E81255] |
− | ** [http://www. | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=F64070 F64070] |
− | * | + | ** [http://pir.georgetown.edu/cgi-bin/nbrfget?uid=S56280 S56280] |
− | ** [http://www. | + | * LIGAND-RXN: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?R03013 R03013] |
− | {{#set: | + | * UNIPROT: |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O34411 O34411] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P10368 P10368] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P06987 P06987] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PM76 Q9PM76] |
+ | ** [http://www.uniprot.org/uniprot/P44327 P44327] | ||
+ | ** [http://www.uniprot.org/uniprot/P38635 P38635] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=histidinol-phosphatase, chloroplast}} | ||
+ | {{#set: ec number=EC-3.1.3.15}} | ||
+ | {{#set: gene associated=Tiso_gene_14713}} | ||
+ | {{#set: in pathway=HISTSYN-PWY}} | ||
+ | {{#set: reconstruction category=manual|annotation}} | ||
+ | {{#set: reconstruction source=manual-primary_network|annotation-experimental_annotation}} | ||
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 20:02, 21 March 2018
Contents
Reaction HISTIDPHOS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- histidinol-phosphatase, chloroplast
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 L-HISTIDINOL-P[c] + 1 WATER[c] => 1 HISTIDINOL[c] + 1 Pi[c]
- With common name(s):
- 1 L-histidinol-phosphate[c] + 1 H2O[c] => 1 histidinol[c] + 1 phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14713
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
Pathways
- HISTSYN-PWY, L-histidine biosynthesis: HISTSYN-PWY
- 10 reactions found over 10 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- RHEA:
- PIR:
- LIGAND-RXN:
- UNIPROT: