Difference between revisions of "CPD0-1327"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15127 RXN-15127] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == * smiles: ** C1(=C(C(=O)NC(N1)=O)F) * common name: ** 5-fluorouracil *...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1327 CPD0-1327] == |
− | * | + | * smiles: |
− | ** | + | ** C1(=C(C(=O)NC(N1)=O)F) |
− | * | + | * common name: |
− | ** | + | ** 5-fluorouracil |
+ | * inchi key: | ||
+ | ** InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 130.078 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[5FLURAt]] | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * DRUGBANK : DB00544 | |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3385 3385] |
− | {{#set: | + | * HMDB : HMDB14684 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C07649 C07649] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.3268.html 3268] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=46345 46345] | ||
+ | {{#set: smiles=C1(=C(C(=O)NC(N1)=O)F)}} | ||
+ | {{#set: common name=5-fluorouracil}} | ||
+ | {{#set: inchi key=InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=130.078 }} | ||
+ | {{#set: reversible reaction associated=5FLURAt}} |
Latest revision as of 21:04, 21 March 2018
Contents
Metabolite CPD0-1327
- smiles:
- C1(=C(C(=O)NC(N1)=O)F)
- common name:
- 5-fluorouracil
- inchi key:
- InChIKey=GHASVSINZRGABV-UHFFFAOYSA-N
- molecular weight:
- 130.078
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links