Difference between revisions of "RXN-1641"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-KETOGLUTARATE 2-KETOGLUTARATE] == * smiles: ** C(CC([O-])=O)C(=O)C([O-])=O * inchi key: ** In...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1641 RXN-1641] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1641 RXN-1641] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.158 EC-2.3.1.158] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * | + | * With identifiers: |
− | * | + | ** 1 [[PHOSPHATIDYLCHOLINE]][c] '''+''' 1 [[DIACYLGLYCEROL]][c] '''=>''' 1 [[2-Lysophosphatidylcholines]][c] '''+''' 1 [[Triacylglycerols]][c] |
− | * [[ | + | * With common name(s): |
− | + | ** 1 a phosphatidylcholine[c] '''+''' 1 a 1,2-diacyl-sn-glycerol[c] '''=>''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''+''' 1 a triacyl-sn-glycerol[c] | |
− | + | ||
− | + | == Genes associated with this reaction == | |
− | + | == Pathways == | |
− | + | * [[TRIGLSYN-PWY]], diacylglycerol and triacylglycerol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=TRIGLSYN-PWY TRIGLSYN-PWY] | |
− | + | ** '''7''' reactions found over '''7''' reactions in the full pathway | |
− | + | * [[PWY-7416]], phospholipid remodeling (phosphatidylcholine, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7416 PWY-7416] | |
− | * | + | ** '''3''' reactions found over '''3''' reactions in the full pathway |
− | * | + | == Reconstruction information == |
− | * | + | * Category: [[annotation]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Tool: [[pathwaytools]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | + | ||
− | * [[ | + | |
− | * | + | |
− | * [[ | + | |
− | * | + | |
− | * | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: ec number=EC-2.3.1.158}} | |
− | + | {{#set: in pathway=TRIGLSYN-PWY|PWY-7416}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:05, 21 March 2018
Contents
Reaction RXN-1641
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PHOSPHATIDYLCHOLINE[c] + 1 DIACYLGLYCEROL[c] => 1 2-Lysophosphatidylcholines[c] + 1 Triacylglycerols[c]
- With common name(s):
- 1 a phosphatidylcholine[c] + 1 a 1,2-diacyl-sn-glycerol[c] => 1 a 1-acyl-sn-glycero-3-phosphocholine[c] + 1 a triacyl-sn-glycerol[c]
Genes associated with this reaction
Pathways
- TRIGLSYN-PWY, diacylglycerol and triacylglycerol biosynthesis: TRIGLSYN-PWY
- 7 reactions found over 7 reactions in the full pathway
- PWY-7416, phospholipid remodeling (phosphatidylcholine, yeast): PWY-7416
- 3 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation