Difference between revisions of "RXN0-6524"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6524 RXN0-6524] == * direction: ** LEFT-TO-RIGHT * common name: ** exosome_complex_exonuclease...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6524 RXN0-6524] ==
−
* smiles:
+
* direction:
−
** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
+
 
* common name:
 
* common name:
−
** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
+
** exosome_complex_exonuclease
−
* molecular weight:
+
* ec number:
−
** 597.259   
+
** [http://enzyme.expasy.org/EC/3.1.13.1 EC-3.1.13.1]
 
* Synonym(s):
 
* Synonym(s):
−
** CDP-ME-2P
 
−
** CDP-methyl-D-erylthritol 2-phosphate
 
−
** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
 
−
** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-302]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** n [[WATER]][c] '''+''' 1 [[RNASE-II-POLY-A-SUBSTRATE-MRNA]][c] '''=>''' n [[AMP]][c] '''+''' 1 [[RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL]][c]
−
* [[2.7.1.148-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** n H2O[c] '''+''' 1 RNase II poly-A substrate mRNA[c] '''=>''' n AMP[c] '''+''' 1 RNase II substrate with no poly-A tail[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11612]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_11613]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430]
+
{{#set: common name=exosome_complex_exonuclease}}
−
* CHEBI:
+
{{#set: ec number=EC-3.1.13.1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919]
+
{{#set: gene associated=Tiso_gene_11612|Tiso_gene_11613}}
−
* BIGG : 2p4c2me
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
{{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}}
+
−
{{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
+
−
{{#set: molecular weight=597.259    }}
+
−
{{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}}
+
−
{{#set: consumed by=RXN0-302}}
+
−
{{#set: produced by=2.7.1.148-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN0-6524

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • exosome_complex_exonuclease
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN0-6524&oldid=45926"