Difference between revisions of "RXN-10828"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10828 RXN-10828] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOPIMELOYL-COA 3-OXOPIMELOYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10828 RXN-10828] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I
+
** [http://enzyme.expasy.org/EC/2.7.8.23 EC-2.7.8.23]
−
* common name:
+
−
** 3-oxopimeloyl-CoA
+
−
* molecular weight:
+
−
** 918.632   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxopimelyl-CoA
 
−
** 3-ketopimeloyl-CoA
 
−
** 3-ketopimelyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[PROTON]][c] '''+''' 1 [[CPD-11740]][c] '''=>''' 1 [[3-HYDROHYDROXYPHOSPHORYLPYRUVATE]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* [[RXN-8032]]
+
* With common name(s):
 +
** 1 H+[c] '''+''' 1 carboxyphosphinopyruvate[c] '''=>''' 1 phosphinopyruvate[c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_2241]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6322]], phosphinothricin tripeptide biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6322 PWY-6322]
 +
** '''2''' reactions found over '''25''' reactions in the full pathway
 +
* [[PWY-7769]], phosalacine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7769 PWY-7769]
 +
** '''2''' reactions found over '''25''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266579 45266579]
+
** [http://www.genome.jp/dbget-bin/www_bget?R08869 R08869]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57350 57350]
+
{{#set: ec number=EC-2.7.8.23}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_2241}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06715 C06715]
+
{{#set: in pathway=PWY-6322|PWY-7769}}
−
* HMDB : HMDB12158
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)=O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
{{#set: inchi key=InChIKey=KJXFOFKTZDJLMQ-UYRKPTJQSA-I}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=3-oxopimeloyl-CoA}}
+
−
{{#set: molecular weight=918.632    }}
+
−
{{#set: common name=3-oxopimelyl-CoA|3-ketopimeloyl-CoA|3-ketopimelyl-CoA}}
+
−
{{#set: consumed or produced by=RXN-8032}}
+

Latest revision as of 20:07, 21 March 2018

Reaction RXN-10828

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6322, phosphinothricin tripeptide biosynthesis: PWY-6322
    • 2 reactions found over 25 reactions in the full pathway
  • PWY-7769, phosalacine biosynthesis: PWY-7769
    • 2 reactions found over 25 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-10828&oldid=46065"