Difference between revisions of "L-methionyl-L-tryptophanyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-tryptophanyl-Protein L-methionyl-L-tryptophanyl-Protein] == * common name: ** an...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-methionyl-L-tryptophanyl-Protein L-methionyl-L-tryptophanyl-Protein] ==
−
* smiles:
+
−
** C(OP([O-])([O-])=O)C([N+])C([O-])=O
+
−
* inchi key:
+
−
** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
+
 
* common name:
 
* common name:
−
** 3-phospho-L-serine
+
** an N-terminal-L-methionyl-L-tryptophanyl-[protein]
−
* molecular weight:
+
−
** 183.057   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O-phospho-L-serine
 
−
** L-serine phosphate
 
−
** phosphoryl-L-serine
 
−
** L-seryl phosphate
 
−
** L-serine-3P
 
−
** L-serine 3-phosphate
 
−
** 3-phospho-L-serine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN0-5114]]
+
* [[RXN-17857]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
* [[PSERTRANSAM-RXN]]
 
 
== External links  ==
 
== External links  ==
−
* CAS : 407-41-0
+
{{#set: common name=an N-terminal-L-methionyl-L-tryptophanyl-[protein]}}
−
* CAS : 17885-08-4
+
{{#set: consumed by=RXN-17857}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387]
+
−
* HMDB : HMDB00272
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524]
+
−
* BIGG : pser__L
+
−
{{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}}
+
−
{{#set: common name=3-phospho-L-serine}}
+
−
{{#set: molecular weight=183.057    }}
+
−
{{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}}
+
−
{{#set: consumed by=RXN0-5114}}
+
−
{{#set: consumed or produced by=PSERTRANSAM-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Metabolite L-methionyl-L-tryptophanyl-Protein

  • common name:
    • an N-terminal-L-methionyl-L-tryptophanyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an N-terminal-L-methionyl-L-tryptophanyl-[protein" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=L-methionyl-L-tryptophanyl-Protein&oldid=46248"