Difference between revisions of "CPD-224"

Latest revision as of 20:08, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19144 CPD-19144] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-224 CPD-224] ==
-* smiles:
-** CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
-* inchi key:
-** InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J
 * common name:
-** (7Z)-hexadecenoyl-CoA
+** a dolichyl diphosphate
-* molecular weight:
-** 999.899
 * Synonym(s):
-** cis-hexadec-7-enoyl-CoA
-** (7Z)-hexadec-7-enoyl-CoA
-** 16:1 cis-7
-** 16:1(n-9)
 == Reaction(s) known to consume the compound ==
-* [[RXN-17779]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17778]]
+* [[2.4.1.119-RXN]]
 == Reaction(s) of unknown directionality ==
+* [[DOLICHYLDIPHOSPHATASE-RXN]]
 == External links  ==
-{{#set: smiles=CCCCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+{{#set: common name=a dolichyl diphosphate}}
-{{#set: inchi key=InChIKey=MJWMOLDKMBISOB-YDGGZUKGSA-J}}
+{{#set: produced by=2.4.1.119-RXN}}
-{{#set: common name=(7Z)-hexadecenoyl-CoA}}
+{{#set: reversible reaction associated=DOLICHYLDIPHOSPHATASE-RXN}}
-{{#set: molecular weight=999.899    }}
-{{#set: common name=cis-hexadec-7-enoyl-CoA|(7Z)-hexadec-7-enoyl-CoA|16:1 cis-7|16:1(n-9)}}
-{{#set: consumed by=RXN-17779}}
-{{#set: produced by=RXN-17778}}