Difference between revisions of "CPD-4186"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_19373 == * left end position: ** 79 * transcription direction: ** POSITIVE * right end position: ** 1868 * centisome position: ** 3.323517...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_19373 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] ==
−
* left end position:
+
* smiles:
−
** 79
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** lathosterol
−
* right end position:
+
* inchi key:
−
** 1868
+
** InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
−
* centisome position:
+
* molecular weight:
−
** 3.323517    
+
** 386.66    
 
* Synonym(s):
 
* Synonym(s):
 +
** 5α-cholest-7-en-3β-ol
 +
** α-cholest-7-en-3β-ol
 +
** cholesta-7-enol
 +
** Δ7-cholesten-3-β-ol
 +
** γ-cholesterol
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[ADDALT-RXN]]
+
* [[1.14.21.6-RXN]]
−
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[ADENODEAMIN-RXN]]
+
−
** in-silico_annotation
+
−
***ec-number
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways associated ==
+
−
* [[PWY-7179]]
+
−
* [[SALVADEHYPOX-PWY]]
+
−
* [[PWY0-1296]]
+
−
* [[PWY-7179-1]]
+
−
* [[PWY-6609]]
+
−
* [[PWY-6611]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=79}}
+
* CAS : 80-99-9
−
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
−
{{#set: right end position=1868}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65728 65728]
−
{{#set: centisome position=3.323517   }}
+
* HMDB : HMDB01170
−
{{#set: reaction associated=ADDALT-RXN|ADENODEAMIN-RXN}}
+
* CHEBI:
−
{{#set: pathway associated=PWY-7179|SALVADEHYPOX-PWY|PWY0-1296|PWY-7179-1|PWY-6609|PWY-6611}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17168 17168]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01189 C01189]
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C}}
 +
{{#set: common name=lathosterol}}
 +
{{#set: inchi key=InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N}}
 +
{{#set: molecular weight=386.66   }}
 +
{{#set: common name=5α-cholest-7-en-3β-ol|α-cholest-7-en-3β-ol|cholesta-7-enol|Δ7-cholesten-3-β-ol|γ-cholesterol}}
 +
{{#set: consumed by=1.14.21.6-RXN}}

Latest revision as of 21:11, 21 March 2018

Metabolite CPD-4186

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
  • common name:
    • lathosterol
  • inchi key:
    • InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
  • molecular weight:
    • 386.66
  • Synonym(s):
    • 5α-cholest-7-en-3β-ol
    • α-cholest-7-en-3β-ol
    • cholesta-7-enol
    • Δ7-cholesten-3-β-ol
    • γ-cholesterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CAS : 80-99-9
  • PUBCHEM:
  • HMDB : HMDB01170
  • CHEBI:
  • LIGAND-CPD:
"CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-4186&oldid=46667"