Difference between revisions of "Tiso gene 5129"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * inchi key: *...")
 
(Created page with "Category:Gene == Gene Tiso_gene_5129 == * right end position: ** 9832 * transcription direction: ** POSITIVE * left end position: ** 7359 * centisome position: ** 53.06843...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] ==
+
== Gene Tiso_gene_5129 ==
* smiles:
+
* right end position:
** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
+
** 9832
* inchi key:
+
* transcription direction:
** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
+
** POSITIVE
* common name:
+
* left end position:
** phytyl monophosphate
+
** 7359
* molecular weight:
+
* centisome position:
** 374.499    
+
** 53.068436    
 
* Synonym(s):
 
* Synonym(s):
** phytolmonophosphate
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[BIS5-ADENOSYL-TRIPHOSPHATASE-RXN]]
* [[RXN-7683]]
+
** Source: [[orthology-athaliana]]
== Reaction(s) of unknown directionality ==
+
* Reaction: [[GSHTRAN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[GST-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-13673]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-15680]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7112]]
 +
* [[PWY-6842]]
 +
* [[PWY-4061]]
 +
* [[PWY-7533]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=9832}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113]
+
{{#set: transcription direction=POSITIVE}}
* CHEBI:
+
{{#set: left end position=7359}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483]
+
{{#set: centisome position=53.068436   }}
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}}
+
{{#set: reaction associated=BIS5-ADENOSYL-TRIPHOSPHATASE-RXN|GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}}
{{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}}
+
{{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}}
{{#set: common name=phytyl monophosphate}}
+
{{#set: molecular weight=374.499   }}
+
{{#set: common name=phytolmonophosphate}}
+
{{#set: produced by=RXN-7683}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_5129

  • right end position:
    • 9832
  • transcription direction:
    • POSITIVE
  • left end position:
    • 7359
  • centisome position:
    • 53.068436
  • Synonym(s):

Reactions associated

Pathways associated

External links