Difference between revisions of "ALCDH nadp hi"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == * direction: ** LEFT-TO-RIGHT * common name: ** alcohol dehydrogena...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ALCDH_nadp_hi ALCDH_nadp_hi] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** ( | + | ** alcohol dehydrogenase (ethanol, NADP), chloroplast |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[1.1.1. | + | * With identifiers: |
| − | + | ** 1.0 [[ACETALD]][h] '''+''' 1.0 [[PROTON]][h] '''+''' 1.0 [[NADPH]][h] '''=>''' 1.0 [[ETOH]][h] '''+''' 1.0 [[NADP]][h] | |
| − | + | * With common name(s): | |
| − | * [[ | + | ** 1.0 acetaldehyde[h] '''+''' 1.0 H+[h] '''+''' 1.0 NADPH[h] '''=>''' 1.0 ethanol[h] '''+''' 1.0 NADP+[h] |
| − | * [[ | + | |
| − | == | + | == Genes associated with this reaction == |
| − | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
| − | * [[ | + | * Gene: [[Tiso_gene_14126]] |
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-creinhardtii]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=alcohol dehydrogenase (ethanol, NADP), chloroplast}} | |
| − | + | {{#set: gene associated=Tiso_gene_14126}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name=( | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:12, 21 March 2018
Contents
Reaction ALCDH_nadp_hi
- direction:
- LEFT-TO-RIGHT
- common name:
- alcohol dehydrogenase (ethanol, NADP), chloroplast
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 acetaldehyde[h] + 1.0 H+[h] + 1.0 NADPH[h] => 1.0 ethanol[h] + 1.0 NADP+[h]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14126
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
