Difference between revisions of "3-hydroxy-cis-D9-hexaecenoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] == * smiles: ** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] == * common name: ** a (3R...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14594 CPD-14594] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-hydroxy-cis-D9-hexaecenoyl-ACPs 3-hydroxy-cis-D9-hexaecenoyl-ACPs] ==
−
* smiles:
+
−
** CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C
+
−
* inchi key:
+
−
** InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N
+
 
* common name:
 
* common name:
−
** linustatin
+
** a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]
−
* molecular weight:
+
−
** 409.389   
+
 
* Synonym(s):
 
* Synonym(s):
−
** propanenitrile
 
−
** [2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13602]]
+
* [[RXN-10660]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10659]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: common name=a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08333 C08333]
+
{{#set: consumed by=RXN-10660}}
−
* CHEBI:
+
{{#set: produced by=RXN-10659}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=6483 6483]
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=119301 119301]
+
−
{{#set: smiles=CC(OC2(OC(COC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)C(O)2))(C#N)C}}
+
−
{{#set: inchi key=InChIKey=FERSMFQBWVBKQK-CXTTVELOSA-N}}
+
−
{{#set: common name=linustatin}}
+
−
{{#set: molecular weight=409.389    }}
+
−
{{#set: common name=propanenitrile|[2-(6-O-β-D-glucopyranosyl-β-D-glucopyranosyloxy)-2-methylpropiononitrile)]}}
+
−
{{#set: consumed by=RXN-13602}}
+

Latest revision as of 20:13, 21 March 2018

Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs

  • common name:
    • a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a (3R)-3-hydroxy cis Δ9-hexadecenoyl-[acp" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-hydroxy-cis-D9-hexaecenoyl-ACPs&oldid=46908"