Difference between revisions of "Tiso gene 12932"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12932 == * right end position: ** 6601 * transcription direction: ** NEGATIVE * left end position: ** 4798 * centisome position: ** 72.4554...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Gene Tiso_gene_12932 ==
−
* smiles:
+
* right end position:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O
+
** 6601
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** ADP ribose 1'',2''-cyclic phosphate
+
** 4798
−
* molecular weight:
+
* centisome position:
−
** 618.26    
+
** 72.45545    
 
* Synonym(s):
 
* Synonym(s):
−
** ADP ribose 1''-2''-cyclic phosphate
 
−
** ADP ribose 1'',2''-phosphate
 
−
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
 
−
** Appr>p
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
* [[2.7.1.160-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6601}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=4798}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
+
{{#set: centisome position=72.45545   }}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC5(C(O)C4(C(OP([O-])(=O)O4)O5)))([O-])=O}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
+
−
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
+
−
{{#set: molecular weight=618.26   }}
+
−
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
+
−
{{#set: produced by=2.7.1.160-RXN}}
+

Latest revision as of 20:17, 21 March 2018

Gene Tiso_gene_12932

  • right end position:
    • 6601
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 4798
  • centisome position:
    • 72.45545
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12932&oldid=47463"