Difference between revisions of "PWY-6120"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C([N+])C...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-AMINO-4-DEOXYCHORISMATE 4-AMINO-4-DEOXYCHORISMATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6120 PWY-6120] ==
* smiles:
+
* taxonomic range:
** C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
** InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 4-amino-4-deoxychorismate
+
** L-tyrosine biosynthesis III
* molecular weight:
+
** 224.193   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[CHORISMATEMUT-RXN]]
* [[ADCLY-RXN]]
+
** 1 associated gene(s):
* [[PABASYN-RXN]]
+
*** [[Tiso_gene_5940]]
 +
** 5 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[manual-primary_network]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=CYCLOHEXADIENYL-DEHYDROGENASE-RXN CYCLOHEXADIENYL-DEHYDROGENASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE-TRANSAMINE-RXN PREPHENATE-TRANSAMINE-RXN]
 
== External links  ==
 
== External links  ==
* CAS : 97279-79-3
+
{{#set: taxonomic range=TAX-3193}}
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266632 45266632]
+
{{#set: taxonomic range=TAX-2}}
* CHEBI:
+
{{#set: common name=L-tyrosine biosynthesis III}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58406 58406]
+
{{#set: reaction found=1}}
* BIGG : 4adcho
+
{{#set: total reaction=3}}
* LIGAND-CPD:
+
{{#set: completion rate=33.0}}
** [http://www.genome.jp/dbget-bin/www_bget?C11355 C11355]
+
{{#set: smiles=C=C(C(=O)[O-])OC1(C([N+])C=CC(C([O-])=O)=C1)}}
+
{{#set: inchi key=InChIKey=OIUJHGOLFKDBSU-HTQZYQBOSA-M}}
+
{{#set: common name=4-amino-4-deoxychorismate}}
+
{{#set: molecular weight=224.193    }}
+
{{#set: consumed or produced by=ADCLY-RXN|PABASYN-RXN}}
+

Latest revision as of 19:11, 21 March 2018

Pathway PWY-6120

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links