Difference between revisions of "Protein-L-methionine-S-S-oxides"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] == * smiles: ** C1(O)(C(O)C(O)C(OP(=O)([...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-S-S-oxides Protein-L-methionine-S-S-oxides] == * common name: ** a protein...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MYO-INOSITOL-4-PHOSPHATE D-MYO-INOSITOL-4-PHOSPHATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Protein-L-methionine-S-S-oxides Protein-L-methionine-S-S-oxides] ==
−
* smiles:
+
−
** C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)
+
−
* inchi key:
+
−
** InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L
+
 
* common name:
 
* common name:
−
** 1D-myo-inositol 4-monophosphate
+
** a protein-L-methionine-(S)-S-oxide
−
* molecular weight:
+
−
** 258.121   
+
 
* Synonym(s):
 
* Synonym(s):
−
** D-myo-inositol 4-phosphate
+
** a peptide-L-methionine-(S)-S-oxide
−
** D-myo-inositol 4-monophosphate
+
−
** inositol 4-phosphate
+
−
** Ins(4)P1
+
−
** Ins(4)P
+
−
** Ins4P
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-10952]]
+
* [[RXN-8668]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[3.1.3.57-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 46495-39-0
+
{{#set: common name=a protein-L-methionine-(S)-S-oxide}}
−
* PUBCHEM:
+
{{#set: common name=a peptide-L-methionine-(S)-S-oxide}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200523 25200523]
+
{{#set: consumed by=RXN-8668}}
−
* HMDB : HMDB01313
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C03546 C03546]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58469 58469]
+
−
* METABOLIGHTS : MTBLC58469
+
−
{{#set: smiles=C1(O)(C(O)C(O)C(OP(=O)([O-])[O-])C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-CNWJWELYSA-L}}
+
−
{{#set: common name=1D-myo-inositol 4-monophosphate}}
+
−
{{#set: molecular weight=258.121    }}
+
−
{{#set: common name=D-myo-inositol 4-phosphate|D-myo-inositol 4-monophosphate|inositol 4-phosphate|Ins(4)P1|Ins(4)P|Ins4P}}
+
−
{{#set: consumed by=RXN-10952}}
+
−
{{#set: produced by=3.1.3.57-RXN}}
+

Latest revision as of 20:19, 21 March 2018

Metabolite Protein-L-methionine-S-S-oxides

  • common name:
    • a protein-L-methionine-(S)-S-oxide
  • Synonym(s):
    • a peptide-L-methionine-(S)-S-oxide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Protein-L-methionine-S-S-oxides&oldid=47821"