Difference between revisions of "D-RIBULOSE-15-P2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10604 RXN-10604] == * direction: ** LEFT-TO-RIGHT * common name: ** type_i_iodothyronine_deiodi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] == * smiles: ** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-]...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10604 RXN-10604] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-RIBULOSE-15-P2 D-RIBULOSE-15-P2] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
 
* common name:
 
* common name:
−
** type_i_iodothyronine_deiodinase
+
** D-ribulose-1,5-bisphosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.21.99.4 EC-1.21.99.4]
+
** InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
 +
* molecular weight:
 +
** 306.059   
 
* Synonym(s):
 
* Synonym(s):
 +
** ribulose 1,5-bisphosphate
 +
** D-ribulose-1,5-diphosphate
 +
** D-ribulose-1,5-P2
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN]]
−
** 1 [[CPD-10813]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[CPD-11395]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-387]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3,3',5'-triiodo-L-thyronine[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 3,3'-diiodothyronine[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 H+[c] '''+''' 1 iodide[c]
+
* [[PHOSPHORIBULOKINASE-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_20481]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6260]], thyroid hormone metabolism I (via deiodination): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6260 PWY-6260]
+
−
** '''3''' reactions found over '''12''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 14689-84-0
−
{{#set: common name=type_i_iodothyronine_deiodinase}}
+
* PUBCHEM:
−
{{#set: ec number=EC-1.21.99.4}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615473 23615473]
−
{{#set: gene associated=Tiso_gene_20481}}
+
* CHEMSPIDER:
−
{{#set: in pathway=PWY-6260}}
+
** [http://www.chemspider.com/Chemical-Structure.3541504.html 3541504]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57870 57870]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C01182 C01182]
 +
{{#set: smiles=C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]}}
 +
{{#set: common name=D-ribulose-1,5-bisphosphate}}
 +
{{#set: inchi key=InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J}}
 +
{{#set: molecular weight=306.059    }}
 +
{{#set: common name=ribulose 1,5-bisphosphate|D-ribulose-1,5-diphosphate|D-ribulose-1,5-P2}}
 +
{{#set: consumed by=RIBULOSE-BISPHOSPHATE-CARBOXYLASE-RXN}}
 +
{{#set: reversible reaction associated=PHOSPHORIBULOKINASE-RXN}}

Latest revision as of 20:20, 21 March 2018

Metabolite D-RIBULOSE-15-P2

  • smiles:
    • C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-]
  • common name:
    • D-ribulose-1,5-bisphosphate
  • inchi key:
    • InChIKey=YAHZABJORDUQGO-NQXXGFSBSA-J
  • molecular weight:
    • 306.059
  • Synonym(s):
    • ribulose 1,5-bisphosphate
    • D-ribulose-1,5-diphosphate
    • D-ribulose-1,5-P2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])([O-])=O)C(O)C(O)C(=O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=D-RIBULOSE-15-P2&oldid=47854"