Difference between revisions of "DXPREDISOM-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] == * smiles: ** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O) * inchi key: ** InChIKe...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DXPREDISOM-RXN DXPREDISOM-RXN] == * direction: ** REVERSIBLE * common name: ** 1-deoxy-d-xylulose_5...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8985 CPD-8985] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DXPREDISOM-RXN DXPREDISOM-RXN] ==
−
* smiles:
+
* direction:
−
** C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N
+
 
* common name:
 
* common name:
−
** (+)-(1R,2R)-1,2-diphenylethane-1,2-diol
+
** 1-deoxy-d-xylulose_5-phosphate_reductoisomerase
−
* molecular weight:
+
* ec number:
−
** 214.263   
+
** [http://enzyme.expasy.org/EC/1.1.1.267 EC-1.1.1.267]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[2-C-METHYL-D-ERYTHRITOL-4-PHOSPHATE]][c] '''+''' 1 [[NADP]][c] '''<=>''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DEOXYXYLULOSE-5P]][c]
−
* [[3.3.2.9-RXN]]
+
* With common name(s):
 +
** 1 2-C-methyl-D-erythritol 4-phosphate[c] '''+''' 1 NADP+[c] '''<=>''' 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 1-deoxy-D-xylulose 5-phosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15169]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=853019 853019]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=13717 13717]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.745456.html 745456]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05688 R05688]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50014 50014]
+
{{#set: common name=1-deoxy-d-xylulose_5-phosphate_reductoisomerase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.1.1.267}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16015 C16015]
+
{{#set: gene associated=Tiso_gene_15169}}
−
* HMDB : HMDB12111
+
{{#set: in pathway=NONMEVIPP-PWY|PWY-7560}}
−
{{#set: smiles=C1(C=CC(=CC=1)C(C(C2(C=CC=CC=2))O)O)}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: inchi key=InChIKey=IHPDTPWNFBQHEB-ZIAGYGMSSA-N}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network|orthology-creinhardtii}}
−
{{#set: common name=(+)-(1R,2R)-1,2-diphenylethane-1,2-diol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=214.263    }}
+
−
{{#set: consumed or produced by=3.3.2.9-RXN}}
+

Latest revision as of 20:21, 21 March 2018

Reaction DXPREDISOM-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • 1-deoxy-d-xylulose_5-phosphate_reductoisomerase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • NONMEVIPP-PWY, methylerythritol phosphate pathway I: NONMEVIPP-PWY
    • 9 reactions found over 9 reactions in the full pathway
  • PWY-7560, methylerythritol phosphate pathway II: PWY-7560
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DXPREDISOM-RXN&oldid=48019"