Difference between revisions of "CPD-5661"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7004 CPD-7004] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC=C(C)CCC=C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == * smiles: ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5661 CPD-5661] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** zeinoxanthin |
+ | * inchi key: | ||
+ | ** InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 552.882 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** β,ε-carotene-3-ol |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-5962]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-5961]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10311902 10311902] |
− | {{#set: smiles= | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.8487368.html 8487368] |
− | {{#set: | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=65244 65244] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: consumed by=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C08590 C08590] |
− | {{#set: produced by=RXN- | + | {{#set: smiles=CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C}} |
+ | {{#set: common name=zeinoxanthin}} | ||
+ | {{#set: inchi key=InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N}} | ||
+ | {{#set: molecular weight=552.882 }} | ||
+ | {{#set: common name=β,ε-carotene-3-ol}} | ||
+ | {{#set: consumed by=RXN-5962}} | ||
+ | {{#set: produced by=RXN-5961}} |
Latest revision as of 21:21, 21 March 2018
Contents
Metabolite CPD-5661
- smiles:
- CC(=CC=CC=C(C=CC=C(C=CC1(=C(CC(CC1(C)C)O)C))C)C)C=CC=C(C=CC2(C(=CCCC2(C)C)C))C
- common name:
- zeinoxanthin
- inchi key:
- InChIKey=NBZANZVJRKXVBH-SZVYCNKZSA-N
- molecular weight:
- 552.882
- Synonym(s):
- β,ε-carotene-3-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links