Difference between revisions of "Tiso gene 15654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O...")
 
(Created page with "Category:Gene == Gene Tiso_gene_15654 == * Synonym(s): == Reactions associated == * Reaction: ADENOSINETRIPHOSPHATASE-RXN ** Source: orthology-esiliculosus == Pat...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8122 CPD-8122] ==
+
== Gene Tiso_gene_15654 ==
* smiles:
+
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]
+
* inchi key:
+
** InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K
+
* common name:
+
** molybdopterin adenine dinucleotide
+
* molecular weight:
+
** 721.529   
+
 
* Synonym(s):
 
* Synonym(s):
** adenylated molybdopterin
 
** H2Dtpp-mADP
 
** molybdopterin-AMP
 
** adenylyl-molybdopterin
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-8348]]
+
* Reaction: [[ADENOSINETRIPHOSPHATASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=ADENOSINETRIPHOSPHATASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356704 53356704]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62727 62727]
+
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP([O-])(=O)OCC5(O[CH]4(NC6(N=C(NC(=O)C(N[CH]4C(=C5[S-])S)=6)N))))(=O)[O-]}}
+
{{#set: inchi key=InChIKey=XJXFAXLUOKQPAQ-YPRLVJTJSA-K}}
+
{{#set: common name=molybdopterin adenine dinucleotide}}
+
{{#set: molecular weight=721.529    }}
+
{{#set: common name=adenylated molybdopterin|H2Dtpp-mADP|molybdopterin-AMP|adenylyl-molybdopterin}}
+
{{#set: consumed by=RXN-8348}}
+

Latest revision as of 20:22, 21 March 2018

Gene Tiso_gene_15654

  • Synonym(s):

Reactions associated

Pathways associated

External links