Difference between revisions of "CPD-7005"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12980 CPD-12980] == * common name: ** an oligosaccharide with 4-deoxy-6-O-methyl-α-D-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == * smiles: ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7005 CPD-7005] == |
| + | * smiles: | ||
| + | ** C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67)))))) | ||
* common name: | * common name: | ||
| − | ** | + | ** geranylgeranyl chlorophyll a |
| + | * inchi key: | ||
| + | ** InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M | ||
| + | * molecular weight: | ||
| + | ** 886.447 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** geranylgeranyl-chl a |
| − | ** | + | ** GG-chl a |
| + | ** GG-chlorophyll a | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-7664]] | ||
| + | * [[RXN-17428]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-7663]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657538 90657538] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64668 64668] | ||
| + | {{#set: smiles=C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))}} | ||
| + | {{#set: common name=geranylgeranyl chlorophyll a}} | ||
| + | {{#set: inchi key=InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M}} | ||
| + | {{#set: molecular weight=886.447 }} | ||
| + | {{#set: common name=geranylgeranyl-chl a|GG-chl a|GG-chlorophyll a}} | ||
| + | {{#set: consumed by=RXN-7664|RXN-17428}} | ||
| + | {{#set: produced by=RXN-7663}} | ||
Latest revision as of 20:22, 21 March 2018
Contents
Metabolite CPD-7005
- smiles:
- C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))
- common name:
- geranylgeranyl chlorophyll a
- inchi key:
- InChIKey=QBLSEPRESQJTCI-ZNLWZYPOSA-M
- molecular weight:
- 886.447
- Synonym(s):
- geranylgeranyl-chl a
- GG-chl a
- GG-chlorophyll a
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC2(=C(C)C5(=CC1(C(C)C(CCC(=O)OCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(N=1)=C7([C-](C(OC)=O)C(=O)C6(C(C)=C4(N([Mg]N(C2=CC3(C(C)=C(CC)C(N=3)=C4))5)C=67))))))" cannot be used as a page name in this wiki.
