Difference between revisions of "CPD-717"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_16879 == * left end position: ** 349 * transcription direction: ** POSITIVE * right end position: ** 2905 * centisome position: ** 8.583374...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-717 CPD-717] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * common name: |
| − | ** | + | ** 3-dehydro-6-deoxoteasterone |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 432.685 |
* Synonym(s): | * Synonym(s): | ||
| + | ** dehydro-deoxoteasterone | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-11535]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-775]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | * [[RXN- | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIPID_MAPS : LMST01030125 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061345 16061345] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20710 20710] |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15800 C15800] | ||
| + | {{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| + | {{#set: common name=3-dehydro-6-deoxoteasterone}} | ||
| + | {{#set: inchi key=InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N}} | ||
| + | {{#set: molecular weight=432.685 }} | ||
| + | {{#set: common name=dehydro-deoxoteasterone}} | ||
| + | {{#set: consumed by=RXN-11535}} | ||
| + | {{#set: produced by=RXN-775}} | ||
Latest revision as of 20:24, 21 March 2018
Contents
Metabolite CPD-717
- smiles:
- CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 3-dehydro-6-deoxoteasterone
- inchi key:
- InChIKey=URNVSZVQLKHKDE-WAFXAADMSA-N
- molecular weight:
- 432.685
- Synonym(s):
- dehydro-deoxoteasterone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
