Difference between revisions of "Tiso gene 7487"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] == * smiles: ** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC...")
 
(Created page with "Category:Gene == Gene Tiso_gene_7487 == * right end position: ** 3280 * transcription direction: ** POSITIVE * left end position: ** 5 * centisome position: ** 4.502881800...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEAMIDO-NAD DEAMIDO-NAD] ==
+
== Gene Tiso_gene_7487 ==
* smiles:
+
* right end position:
** C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)
+
** 3280
* inchi key:
+
* transcription direction:
** InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L
+
** POSITIVE
* common name:
+
* left end position:
** nicotinate adenine dinucleotide
+
** 5
* molecular weight:
+
* centisome position:
** 662.399   
+
** 4.502881800e-2
 
* Synonym(s):
 
* Synonym(s):
** Deamino-NAD+
 
** NaADN
 
** deamido-NAD+
 
** deamidonicotinamide adenine dinucleoetide
 
** deamido-NAD
 
** NAAD
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[DNNH]]
+
* Reaction: [[2.7.1.68-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
* [[NICONUCADENYLYLTRAN-RXN]]
+
*** Assignment: automated-name-match
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6352]]
 +
* [[PWY-6351]]
 
== External links  ==
 
== External links  ==
* CAS : 6450-77-7
+
{{#set: right end position=3280}}
* DRUGBANK : DB04099
+
{{#set: transcription direction=POSITIVE}}
* PUBCHEM:
+
{{#set: left end position=5}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266646 45266646]
+
{{#set: centisome position=4.502881800e-2}}
* HMDB : HMDB01179
+
{{#set: reaction associated=2.7.1.68-RXN}}
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-6352|PWY-6351}}
** [http://www.genome.jp/dbget-bin/www_bget?C00857 C00857]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58437 58437]
+
* BIGG : dnad
+
{{#set: smiles=C1(C(=CC=C[N+]=1C5(OC(COP(=O)([O-])OP(=O)([O-])OCC2(OC(C(O)C(O)2)N4(C=NC3(C(N)=NC=NC=34))))C(O)C(O)5))C([O-])=O)}}
+
{{#set: inchi key=InChIKey=SENPVEZBRZQVST-HISDBWNOSA-L}}
+
{{#set: common name=nicotinate adenine dinucleotide}}
+
{{#set: molecular weight=662.399    }}
+
{{#set: common name=Deamino-NAD+|NaADN|deamido-NAD+|deamidonicotinamide adenine dinucleoetide|deamido-NAD|NAAD}}
+
{{#set: consumed by=DNNH}}
+
{{#set: produced by=NICONUCADENYLYLTRAN-RXN}}
+

Latest revision as of 20:24, 21 March 2018

Gene Tiso_gene_7487

  • right end position:
    • 3280
  • transcription direction:
    • POSITIVE
  • left end position:
    • 5
  • centisome position:
    • 4.502881800e-2
  • Synonym(s):

Reactions associated

Pathways associated

External links