Difference between revisions of "CPD-702"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_12792 == * left end position: ** 3927 * transcription direction: ** POSITIVE * right end position: ** 6529 * centisome position: ** 58.4810...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] == * smiles: ** C(O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenzy...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_12792 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-702 CPD-702] ==
* left end position:
+
* smiles:
** 3927
+
** C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
* transcription direction:
+
* common name:
** POSITIVE
+
** 4-nitrobenzyl alcohol
* right end position:
+
* inchi key:
** 6529
+
** InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
* centisome position:
+
* molecular weight:
** 58.481014    
+
** 153.137    
 
* Synonym(s):
 
* Synonym(s):
 +
** 4NBA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[3.1.4.17-RXN]]
+
== Reaction(s) known to produce the compound ==
** in-silico_annotation
+
* [[RXN0-5141]]
***ec-number
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[esiliculosus]]
+
* [[35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN]]
+
** [[pantograph]]-[[creinhardtii]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[APN]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN0-5038]]
+
** [[pantograph]]-[[creinhardtii]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3927}}
+
* CAS : 619-73-8
{{#set: transcription direction=POSITIVE}}
+
* PUBCHEM:
{{#set: right end position=6529}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=69275 69275]
{{#set: centisome position=58.481014   }}
+
* CHEMSPIDER:
{{#set: reaction associated=3.1.4.17-RXN|35-CYCLIC-GMP-PHOSPHODIESTERASE-RXN|APN|RXN0-5038}}
+
** [http://www.chemspider.com/Chemical-Structure.13585105.html 13585105]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=41214 41214]
 +
* NCI:
 +
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5389 5389]
 +
{{#set: smiles=C(O)C1(C=CC(=CC=1)[N+]([O-])=O)}}
 +
{{#set: common name=4-nitrobenzyl alcohol}}
 +
{{#set: inchi key=InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N}}
 +
{{#set: molecular weight=153.137   }}
 +
{{#set: common name=4NBA}}
 +
{{#set: produced by=RXN0-5141}}

Latest revision as of 20:24, 21 March 2018

Metabolite CPD-702

  • smiles:
    • C(O)C1(C=CC(=CC=1)[N+]([O-])=O)
  • common name:
    • 4-nitrobenzyl alcohol
  • inchi key:
    • InChIKey=JKTYGPATCNUWKN-UHFFFAOYSA-N
  • molecular weight:
    • 153.137
  • Synonym(s):
    • 4NBA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.