Difference between revisions of "DNA-LIGASE-ATP-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-METHYLXANTHINE 7-METHYLXANTHINE] == * smiles: ** CN1(C=NC2(NC(=O)NC(=O)C1=2)) * inchi key: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** dna_ligas...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DNA-LIGASE-ATP-RXN DNA-LIGASE-ATP-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 7- | + | ** dna_ligase |
− | * | + | ** dna_ligase_mrna_capping_enzyme |
− | ** | + | ** ORF |
+ | * ec number: | ||
+ | ** [http://enzyme.expasy.org/EC/6.5.1.7 EC-6.5.1.7] | ||
+ | ** [http://enzyme.expasy.org/EC/6.5.1.1 EC-6.5.1.1] | ||
+ | ** [http://enzyme.expasy.org/EC/6.5.1.6 EC-6.5.1.6] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[3-Hydroxy-Terminated-DNAs]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[5-Phospho-terminated-DNAs]][c] '''=>''' 1 [[DNA-N]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [DNA]-3'-hydroxyl[c] '''+''' 1 ATP[c] '''+''' 1 a 5'-phospho-[DNA][c] '''=>''' 1 DNAn[c] '''+''' 1 diphosphate[c] '''+''' 1 AMP[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_11251]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_3498]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14250]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_6743]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14249]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_12142]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00381 R00381] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P12000 P12000] |
− | * | + | ** [http://www.uniprot.org/uniprot/P18858 P18858] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P35970 P35970] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9QNG8 Q9QNG8] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q9PM08 Q9PM08] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q57635 Q57635] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49917 P49917] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49916 P49916] |
− | {{#set: common name=7- | + | ** [http://www.uniprot.org/uniprot/P37913 P37913] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P51892 P51892] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P16272 P16272] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P33798 P33798] |
+ | ** [http://www.uniprot.org/uniprot/P00970 P00970] | ||
+ | ** [http://www.uniprot.org/uniprot/P00969 P00969] | ||
+ | ** [http://www.uniprot.org/uniprot/P04819 P04819] | ||
+ | ** [http://www.uniprot.org/uniprot/P19088 P19088] | ||
+ | ** [http://www.uniprot.org/uniprot/P07717 P07717] | ||
+ | ** [http://www.uniprot.org/uniprot/P26813 P26813] | ||
+ | ** [http://www.uniprot.org/uniprot/Q02093 Q02093] | ||
+ | ** [http://www.uniprot.org/uniprot/Q23694 Q23694] | ||
+ | ** [http://www.uniprot.org/uniprot/Q67480 Q67480] | ||
+ | ** [http://www.uniprot.org/uniprot/Q42572 Q42572] | ||
+ | ** [http://www.uniprot.org/uniprot/P20492 P20492] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=dna_ligase}} | ||
+ | {{#set: common name=dna_ligase_mrna_capping_enzyme}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: ec number=EC-6.5.1.7}} | ||
+ | {{#set: ec number=EC-6.5.1.1}} | ||
+ | {{#set: ec number=EC-6.5.1.6}} | ||
+ | {{#set: gene associated=Tiso_gene_11251|Tiso_gene_3498|Tiso_gene_14250|Tiso_gene_6743|Tiso_gene_14249|Tiso_gene_12142}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:06, 21 March 2018
Contents
Reaction DNA-LIGASE-ATP-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- dna_ligase
- dna_ligase_mrna_capping_enzyme
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 3-Hydroxy-Terminated-DNAs[c] + 1 ATP[c] + 1 5-Phospho-terminated-DNAs[c] => 1 DNA-N[c] + 1 PPI[c] + 1 AMP[c]
- With common name(s):
- 1 a [DNA]-3'-hydroxyl[c] + 1 ATP[c] + 1 a 5'-phospho-[DNA][c] => 1 DNAn[c] + 1 diphosphate[c] + 1 AMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_11251
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3498
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14250
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_6743
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14249
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12142
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
- UNIPROT: