Difference between revisions of "CPD-4581"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=M5TAP M5TAP] == * direction: ** LEFT-TO-RIGHT * common name: ** S-methyl-5'-thioadenosine phosphory...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34)))) |
* common name: | * common name: | ||
− | ** | + | ** 5α-cholesta-8,24-dien-3-one |
+ | * inchi key: | ||
+ | ** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N | ||
+ | * molecular weight: | ||
+ | ** 382.628 | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN66-318]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942] |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386] | |
− | {{#set: | + | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}} |
− | {{#set: | + | {{#set: common name=5α-cholesta-8,24-dien-3-one}} |
− | + | {{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}} | |
+ | {{#set: molecular weight=382.628 }} | ||
+ | {{#set: produced by=RXN66-318}} |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-4581
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
- common name:
- 5α-cholesta-8,24-dien-3-one
- inchi key:
- InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
- molecular weight:
- 382.628
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.