Difference between revisions of "RXN-14192"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] == * smiles: ** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] == * direction: ** REVERSIBLE * common name: ** pyruvate_kinase * ec number: *...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=7-CYANO-7-DEAZAGUANINE 7-CYANO-7-DEAZAGUANINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14192 RXN-14192] ==
−
* smiles:
+
* direction:
−
** C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** preQ0
+
** pyruvate_kinase
−
* molecular weight:
+
* ec number:
−
** 175.149   
+
** [http://enzyme.expasy.org/EC/2.7.1.40 EC-2.7.1.40]
 
* Synonym(s):
 
* Synonym(s):
−
** 7-cyano-7-deazaguanine
 
−
** 7-cyano-7-carbaguanine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-12093]]
+
** 1 [[DATP]][c] '''+''' 1 [[PYRUVATE]][c] '''<=>''' 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[DADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 dATP[c] '''+''' 1 pyruvate[c] '''<=>''' 1 phosphoenolpyruvate[c] '''+''' 1 H+[c] '''+''' 1 dADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18206]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14505]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14504]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_974]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03074
+
* RHEA:
−
* PUBCHEM:
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30730 30730]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=446357 446357]
+
* LIGAND-RXN:
−
* CHEMSPIDER:
+
** [http://www.genome.jp/dbget-bin/www_bget?R01138 R01138]
−
** [http://www.chemspider.com/Chemical-Structure.393739.html 393739]
+
{{#set: direction=REVERSIBLE}}
−
* CHEBI:
+
{{#set: common name=pyruvate_kinase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45075 45075]
+
{{#set: ec number=EC-2.7.1.40}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_18206|Tiso_gene_14505|Tiso_gene_14504|Tiso_gene_974}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15996 C15996]
+
{{#set: in pathway=}}
−
{{#set: smiles=C12(=C(C(NC(=N1)N)=O)C(=CN2)C#N)}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=FMKSMYDYKXQYRV-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-creinhardtii|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=preQ0}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=175.149    }}
+
−
{{#set: common name=7-cyano-7-deazaguanine|7-cyano-7-carbaguanine}}
+
−
{{#set: produced by=RXN-12093}}
+

Latest revision as of 19:07, 21 March 2018

Reaction RXN-14192

  • direction:
    • REVERSIBLE
  • common name:
    • pyruvate_kinase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14192&oldid=39656"