Difference between revisions of "PWY-5523"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * smiles: ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == |
* smiles: | * smiles: | ||
− | ** C([N+]) | + | ** C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M |
* common name: | * common name: | ||
− | ** | + | ** 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 826.095 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** triiodothyronine glucuronide |
+ | ** beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)- | ||
+ | ** T3G | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-10607]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659063 90659063] |
− | + | {{#set: smiles=C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))}} | |
− | + | {{#set: inchi key=InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M}} | |
− | + | {{#set: common name=3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide}} | |
− | + | {{#set: molecular weight=826.095 }} | |
− | + | {{#set: common name=triiodothyronine glucuronide|beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-|T3G}} | |
− | + | {{#set: produced by=RXN-10607}} | |
− | + | ||
− | + | ||
− | {{#set: smiles=C([N+]) | + | |
− | {{#set: inchi key=InChIKey= | + | |
− | {{#set: common name= | + | |
− | {{#set: molecular weight= | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 17:57, 18 March 2018
Contents
Metabolite CPD-11400
- smiles:
- C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))
- inchi key:
- InChIKey=YYFGGGCINNGOLE-ZDXOGFQLSA-M
- common name:
- 3,5,3'-triiodo-L-thyronine phenolic β-D-glucuronide
- molecular weight:
- 826.095
- Synonym(s):
- triiodothyronine glucuronide
- beta-D-glucopyranosiduronic acid, 4-(4-(2-amino-2-carboxyethyl)-2,6-diiodophenoxy)-2-iodophenyl, (S)-
- T3G
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C([N+])CC1(=CC(I)=C(C(I)=C1)OC3(C=CC(OC2(OC(C(=O)[O-])C(O)C(O)C(O)2))=C(I)C=3))" cannot be used as a page name in this wiki.