Difference between revisions of "Tiso gene 1396"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] == * direction: ** LEFT-TO-RIGHT * common name: ** folic_acid_synthesis_protei...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=P-COUMAROYL-COA P-COUMAROYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15733 RXN-15733] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J
+
 
* common name:
 
* common name:
−
** 4-coumaroyl-CoA
+
** folic_acid_synthesis_protein
−
* molecular weight:
+
* ec number:
−
** 909.648   
+
** [http://enzyme.expasy.org/EC/2.7.6.3 EC-2.7.6.3]
 
* Synonym(s):
 
* Synonym(s):
−
** p-coumaroyl-CoA
 
−
** 4-hydroxycinnamoyl-CoA
 
−
** 4-coumaryl-CoA
 
−
** p-coumaryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-11244]]
+
* With identifiers:
−
* [[RXN-1101]]
+
** 1 [[CPD-16953]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[CPD-16954]][c]
−
* [[RXN-3142]]
+
* With common name(s):
−
== Reaction(s) known to produce the compound ==
+
** 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c]
−
* [[4-COUMARATE--COA-LIGASE-RXN]]
+
 
−
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_11659]]
 +
** IN-SILICO_ANNOTATION
 +
***EC-NUMBER
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6148]], tetrahydromethanopterin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6148 PWY-6148]
 +
** '''2''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266584 45266584]
+
{{#set: common name=folic_acid_synthesis_protein}}
−
* CHEBI:
+
{{#set: ec number=EC-2.7.6.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15499 15499]
+
{{#set: gene associated=Tiso_gene_11659}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6148}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00223 C00223]
+
{{#set: reconstruction category=orthology|annotation}}
−
* HMDB : HMDB60153
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(C=CC(O)=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=DMZOKBALNZWDKI-MATMFAIHSA-J}}
+
−
{{#set: common name=4-coumaroyl-CoA}}
+
−
{{#set: molecular weight=909.648    }}
+
−
{{#set: common name=p-coumaroyl-CoA|4-hydroxycinnamoyl-CoA|4-coumaryl-CoA|p-coumaryl-CoA}}
+
−
{{#set: consumed by=RXN-11244|RXN-1101|RXN-3142}}
+
−
{{#set: produced by=4-COUMARATE--COA-LIGASE-RXN}}
+

Revision as of 17:57, 18 March 2018

Reaction RXN-15733

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • folic_acid_synthesis_protein
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin[c] + 1 ATP[c] => 1 H+[c] + 1 AMP[c] + 1 [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3H-pteridin-6-yl)]ethyl diphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6148, tetrahydromethanopterin biosynthesis: PWY-6148
    • 2 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1396&oldid=20856"