Difference between revisions of "CPD1F-136"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4573 CPD-4573] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C=O)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M |
* common name: | * common name: | ||
| − | ** | + | ** ent-7α-hydroxykaur-16-en-19-oate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 317.447 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ent-7-α-hydroxykaurenoate |
| − | ** | + | ** ent-7-α-hydroxykaurenoic acid |
| + | ** 7-hydroxy-kaurenoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN1F-160]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[1.14.13.79-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * LIPID_MAPS : LMPR0104540005 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352] |
| − | {{#set: smiles= | + | * CHEBI: |
| − | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: molecular weight= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875] |
| − | {{#set: common name= | + | {{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}} |
| − | {{#set: consumed by= | + | {{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}} |
| − | {{#set: produced by= | + | {{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}} |
| + | {{#set: molecular weight=317.447 }} | ||
| + | {{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}} | ||
| + | {{#set: consumed by=RXN1F-160}} | ||
| + | {{#set: produced by=1.14.13.79-RXN}} | ||
Revision as of 17:58, 18 March 2018
Contents
Metabolite CPD1F-136
- smiles:
- C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
- inchi key:
- InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
- common name:
- ent-7α-hydroxykaur-16-en-19-oate
- molecular weight:
- 317.447
- Synonym(s):
- ent-7-α-hydroxykaurenoate
- ent-7-α-hydroxykaurenoic acid
- 7-hydroxy-kaurenoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))" cannot be used as a page name in this wiki.
