Difference between revisions of "CPD-7033"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...")
(Created page with "Category:Gene == Gene Tiso_gene_17329 == * Synonym(s): == Reactions associated == * GSADENYLATION-RXN ** pantograph-esiliculosus * RXN-8348 ** pantograp...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] ==
+
== Gene Tiso_gene_17329 ==
* smiles:
+
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
+
* inchi key:
+
** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
+
* common name:
+
** 3,3',5-triiodothyroacetate
+
* molecular weight:
+
** 620.928   
+
 
* Synonym(s):
 
* Synonym(s):
** 3,3',5-triiodothyroacetic acid
 
** Triac
 
** Tiratricol
 
** Tiracana
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-10618]]
+
* [[GSADENYLATION-RXN]]
* [[RXN-10619]]
+
** [[pantograph]]-[[esiliculosus]]
== Reaction(s) known to produce the compound ==
+
* [[RXN-8348]]
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6823]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=GSADENYLATION-RXN|RXN-8348}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629]
+
{{#set: pathway associated=PWY-6823}}
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972]
+
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}}
+
{{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}}
+
{{#set: common name=3,3',5-triiodothyroacetate}}
+
{{#set: molecular weight=620.928    }}
+
{{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}}
+
{{#set: consumed by=RXN-10618|RXN-10619}}
+

Revision as of 18:01, 18 March 2018

Gene Tiso_gene_17329

  • Synonym(s):

Reactions associated

Pathways associated

External links