Difference between revisions of "CPD-7033"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * in...") |
(Created page with "Category:Gene == Gene Tiso_gene_17329 == * Synonym(s): == Reactions associated == * GSADENYLATION-RXN ** pantograph-esiliculosus * RXN-8348 ** pantograp...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17329 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[GSADENYLATION-RXN]] |
− | * [[RXN- | + | ** [[pantograph]]-[[esiliculosus]] |
− | + | * [[RXN-8348]] | |
− | == | + | ** [[pantograph]]-[[esiliculosus]] |
+ | == Pathways associated == | ||
+ | * [[PWY-6823]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=GSADENYLATION-RXN|RXN-8348}} | |
− | + | {{#set: pathway associated=PWY-6823}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Revision as of 18:01, 18 March 2018
Gene Tiso_gene_17329
- Synonym(s):