Difference between revisions of "Tiso gene 12892"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15682 == * Synonym(s): == Reactions associated == * CYTOCHROME-C-OXIDASE-RXN ** pantograph-esiliculosus * RXN-15830 ** p...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] == * smiles: ** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_15682 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2105 CPD0-2105] ==
 +
* smiles:
 +
** CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
 +
* common name:
 +
** 3-oxododecanoyl-CoA
 +
* molecular weight:
 +
** 959.791   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-oxolauroyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[CYTOCHROME-C-OXIDASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-15830]]
+
* [[HACD5m]]
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-14274]]
== Pathways associated ==
+
* [[HACD5]]
* [[PWY-6692]]
+
* [[PWY-7279]]
+
* [[PWY-3781]]
+
* [[PWY-4521]]
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=CYTOCHROME-C-OXIDASE-RXN|RXN-15830}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-6692|PWY-7279|PWY-3781|PWY-4521}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C05263 C05263]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62615 62615]
 +
* BIGG : 3oddcoa
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173506 46173506]
 +
* HMDB : HMDB03937
 +
{{#set: smiles=CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: inchi key=InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J}}
 +
{{#set: common name=3-oxododecanoyl-CoA}}
 +
{{#set: molecular weight=959.791    }}
 +
{{#set: common name=3-oxolauroyl-CoA}}
 +
{{#set: reversible reaction associated=HACD5m|RXN-14274|HACD5}}

Revision as of 18:01, 18 March 2018

Metabolite CPD0-2105

  • smiles:
    • CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=HQANBZHVWIDNQZ-GMHMEAMDSA-J
  • common name:
    • 3-oxododecanoyl-CoA
  • molecular weight:
    • 959.791
  • Synonym(s):
    • 3-oxolauroyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.