Difference between revisions of "Co-chaperone-SP-2Fe2S-Complex"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] == * smiles: ** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AASP AASP] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:adenylylsulfate 3'-phosphotransfe...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11763 CPD-11763] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AASP AASP] ==
−
* smiles:
+
* direction:
−
** C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** bisorganyltrisulfane
+
** ATP:adenylylsulfate 3'-phosphotransferase
−
* molecular weight:
+
−
** 644.686   
+
 
* Synonym(s):
 
* Synonym(s):
−
** GS3G
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[APS]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[PAPS]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ADP]][c]
−
* [[RXN-10851]]
+
* With common name(s):
 +
** 1.0 adenosine 5'-phosphosulfate[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 3'-phosphoadenylyl-sulfate[c] '''+''' 1.0 H+[c] '''+''' 1.0 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_17878]]
 +
** [[pantograph]]-[[creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479371 45479371]
+
{{#set: common name=ATP:adenylylsulfate 3'-phosphotransferase}}
−
{{#set: smiles=C(SSSCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC(=O)[O-])C(C(O)NCC(=O)[O-])NC(CCC(C([O-])=O)[N+])=O}}
+
{{#set: gene associated=Tiso_gene_17878}}
−
{{#set: inchi key=InChIKey=IMZRQZICOZIGNP-UHFFFAOYSA-L}}
+
{{#set: in pathway=}}
−
{{#set: common name=bisorganyltrisulfane}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: molecular weight=644.686    }}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=GS3G}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: consumed or produced by=RXN-10851}}
+

Revision as of 18:03, 18 March 2018

Reaction AASP

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:adenylylsulfate 3'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 adenosine 5'-phosphosulfate[c] + 1.0 ATP[c] => 1.0 3'-phosphoadenylyl-sulfate[c] + 1.0 H+[c] + 1.0 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Co-chaperone-SP-2Fe2S-Complex&oldid=21534"