Difference between revisions of "Tiso gene 12252"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15977 CPD-15977] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)OC(CCCCCCCC=CCCCCCCCC)=O * i...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCO_nadp HBCO_nadp] == * direction: ** REVERSIBLE * common name: ** 3-Hydroxybutanoyl-CoA:NADP+ ox...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HBCO_nadp HBCO_nadp] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 3-Hydroxybutanoyl-CoA:NADP+ oxidoreductase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1.0 [[NADPH]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[ACETOACETYL-COA]][c] '''<=>''' 1.0 [[NADP]][c] '''+''' 1.0 [[S-3-HYDROXYBUTANOYL-COA]][c] |
− | == | + | * With common name(s): |
+ | ** 1.0 NADPH[c] '''+''' 1.0 H+[c] '''+''' 1.0 acetoacetyl-CoA[c] '''<=>''' 1.0 NADP+[c] '''+''' 1.0 (S)-3-hydroxybutanoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Tiso_gene_14027]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | * [[Tiso_gene_14026]] | ||
+ | ** [[pantograph]]-[[creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=3-Hydroxybutanoyl-CoA:NADP+ oxidoreductase}} | |
− | + | {{#set: gene associated=Tiso_gene_14027|Tiso_gene_14026}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii}} | |
− | + | {{#set: reconstruction tool=pantograph}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:05, 18 March 2018
Contents
Reaction HBCO_nadp
- direction:
- REVERSIBLE
- common name:
- 3-Hydroxybutanoyl-CoA:NADP+ oxidoreductase
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 NADPH[c] + 1.0 PROTON[c] + 1.0 ACETOACETYL-COA[c] <=> 1.0 NADP[c] + 1.0 S-3-HYDROXYBUTANOYL-COA[c]
- With common name(s):
- 1.0 NADPH[c] + 1.0 H+[c] + 1.0 acetoacetyl-CoA[c] <=> 1.0 NADP+[c] + 1.0 (S)-3-hydroxybutanoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii