Difference between revisions of "CPD-16001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FERULIC-ACID FERULIC-ACID] == * smiles: ** COC1(=CC(C=CC([O-])=O)=CC=C(O)1) * inchi key: ** InC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ceramides Ceramides] == * common name: ** a ceramide * Synonym(s): ** an N-acylsphingosine ** a...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ceramides Ceramides] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a ceramide |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** an N-acylsphingosine |
− | + | ** a sphingosine-containing ceramide | |
− | ** | + | |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-11375]] | |
− | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[SPHINGOMYELIN-PHOSPHODIESTERASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a ceramide}} | |
− | + | {{#set: common name=an N-acylsphingosine|a sphingosine-containing ceramide}} | |
− | + | {{#set: consumed by=RXN-11375}} | |
− | + | {{#set: produced by=SPHINGOMYELIN-PHOSPHODIESTERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Revision as of 18:15, 18 March 2018
Contents
Metabolite Ceramides
- common name:
- a ceramide
- Synonym(s):
- an N-acylsphingosine
- a sphingosine-containing ceramide