Difference between revisions of "Dihydroquercetins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] == * smiles: ** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C...")
(Created page with "Category:Gene == Gene Tiso_gene_9460 == * left end position: ** 6601 * transcription direction: ** NEGATIVE * right end position: ** 9279 * centisome position: ** 70.7351...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11407 CPD-11407] ==
+
== Gene Tiso_gene_9460 ==
−
* smiles:
+
* left end position:
−
** C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)
+
** 6601
−
* inchi key:
+
* transcription direction:
−
** InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** thyroxine sulfate
+
** 9279
−
* molecular weight:
+
* centisome position:
−
** 855.924    
+
** 70.7351    
 
* Synonym(s):
 
* Synonym(s):
−
** T4 sulfate
 
−
** thyroxine-4-sulfate
 
−
** L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[3.6.3.50-RXN]]
−
* [[RXN-10614]]
+
** [[pantograph]]-[[esiliculosus]]
−
== Reaction(s) of unknown directionality ==
+
* [[ATPASE-RXN]]
 +
** [[pantograph]]-[[athaliana]]
 +
* [[ATPSYN-RXN]]
 +
** in-silico_annotation
 +
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
== Pathways associated ==
 +
* [[PWY-7219]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6601}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657726 90657726]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=9279}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58910 58910]
+
{{#set: centisome position=70.7351   }}
−
{{#set: smiles=C2(C(I)=C(OC1(C=C(C(OS(=O)(=O)[O-])=C(C=1)I)I))C(=CC=2CC(C(=O)[O-])[N+])I)}}
+
{{#set: reaction associated=3.6.3.50-RXN|ATPASE-RXN|ATPSYN-RXN}}
−
{{#set: inchi key=InChIKey=QYXIJUZWSSQICT-LBPRGKRZSA-M}}
+
{{#set: pathway associated=PWY-7219}}
−
{{#set: common name=thyroxine sulfate}}
+
−
{{#set: molecular weight=855.924   }}
+
−
{{#set: common name=T4 sulfate|thyroxine-4-sulfate|L-tyrosine, O-(3,5-diiodo-4-(sulfooxy)phenyl)-3,5-diiodo-}}
+
−
{{#set: produced by=RXN-10614}}
+

Revision as of 18:16, 18 March 2018

Gene Tiso_gene_9460

  • left end position:
    • 6601
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 9279
  • centisome position:
    • 70.7351
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Dihydroquercetins&oldid=23150"