|
|
| Line 1: |
Line 1: |
| − | [[Category:Metabolite]] | + | [[Category:Gene]] |
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == | + | == Gene Tiso_gene_11407 == |
| − | * smiles:
| + | |
| − | ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))
| + | |
| − | * inchi key:
| + | |
| − | ** InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L
| + | |
| − | * common name:
| + | |
| − | ** (6S)-5-formyl-tetrahydrofolate mono-L-glutamate
| + | |
| − | * molecular weight:
| + | |
| − | ** 471.429
| + | |
| | * Synonym(s): | | * Synonym(s): |
| − | ** n5-formyltetrahydrofolate monoglutamate
| |
| − | ** n5-formyl-thf monoglutamate
| |
| − | ** N5-formyl-THF monoglutamate
| |
| − | ** 5-formyl-H4F monoglutamate
| |
| − | ** 5-formyl-THF monoglutamate
| |
| − | ** folinic acid monoglutamate
| |
| − | ** 5-CHO-THF monoglutamate
| |
| − | ** folinate
| |
| − | ** formyl-H4F monoglutamate
| |
| − | ** citrovorum factor
| |
| − | ** N5-formyl-H4F monoglutamate
| |
| − | ** N5-formyl-H4PteGlu1
| |
| − | ** (6S)-leucovorin
| |
| | | | |
| − | == Reaction(s) known to consume the compound == | + | == Reactions associated == |
| − | == Reaction(s) known to produce the compound ==
| + | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] |
| − | == Reaction(s) of unknown directionality ==
| + | ** [[pantograph]]-[[esiliculosus]] |
| − | * [[5FTHFt]] | + | == Pathways associated == |
| − | * [[5FTHFtm]] | + | * [[PWY-7511]] |
| | == External links == | | == External links == |
| − | * CAS : 58-05-9
| + | {{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}} |
| − | * PUBCHEM:
| + | {{#set: pathway associated=PWY-7511}} |
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560146 6560146]
| + | |
| − | * HMDB : HMDB01562
| + | |
| − | * LIGAND-CPD:
| + | |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?C03479 C03479]
| + | |
| − | * CHEMSPIDER:
| + | |
| − | ** [http://www.chemspider.com/Chemical-Structure.5028014.html 5028014]
| + | |
| − | * CHEBI:
| + | |
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57457 57457]
| + | |
| − | * METABOLIGHTS : MTBLC57457
| + | |
| − | {{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))}} | + | |
| − | {{#set: inchi key=InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L}}
| + | |
| − | {{#set: common name=(6S)-5-formyl-tetrahydrofolate mono-L-glutamate}} | + | |
| − | {{#set: molecular weight=471.429 }}
| + | |
| − | {{#set: common name=n5-formyltetrahydrofolate monoglutamate|n5-formyl-thf monoglutamate|N5-formyl-THF monoglutamate|5-formyl-H4F monoglutamate|5-formyl-THF monoglutamate|folinic acid monoglutamate|5-CHO-THF monoglutamate|folinate|formyl-H4F monoglutamate|citrovorum factor|N5-formyl-H4F monoglutamate|N5-formyl-H4PteGlu1|(6S)-leucovorin}}
| + | |
| − | {{#set: consumed or produced by=5FTHFt|5FTHFtm}}
| + | |
