Difference between revisions of "4.2.1.61-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/6....") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-742 RXN0-742] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | * ec number: | |
− | + | ** [http://enzyme.expasy.org/EC/6.3.4.18 EC-6.3.4.18] | |
− | * | + | |
− | ** | + | |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE]][c] '''+''' 1 [[HCO3]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Pi]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[CPD0-181]][c] '''+''' 1 [[ADP]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 5-amino-1-(5-phospho-β-D-ribosyl)imidazole[c] '''+''' 1 hydrogencarbonate[c] '''+''' 1 ATP[c] '''=>''' 1 phosphate[c] '''+''' 2 H+[c] '''+''' 1 N5-carboxyaminoimidazole ribonucleotide[c] '''+''' 1 ADP[c] |
− | == | + | |
− | == | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * [[Tiso_gene_16011]] | ||
+ | ** [[pantograph]]-[[synechocystis]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6123]], inosine-5'-phosphate biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6123 PWY-6123] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-7234]], inosine-5'-phosphate biosynthesis III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7234 PWY-7234] | ||
+ | ** '''4''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19317 19317] | |
− | ** [http:// | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07404 R07404] | |
− | * LIGAND- | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-6.3.4.18}} |
− | + | {{#set: gene associated=Tiso_gene_16011}} | |
− | + | {{#set: in pathway=PWY-6123|PWY-7234}} | |
− | + | {{#set: reconstruction category=orthology}} | |
− | {{#set: | + | {{#set: reconstruction source=orthology-synechocystis}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 18:31, 18 March 2018
Contents
Reaction RXN0-742
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 5-amino-1-(5-phospho-β-D-ribosyl)imidazole[c] + 1 hydrogencarbonate[c] + 1 ATP[c] => 1 phosphate[c] + 2 H+[c] + 1 N5-carboxyaminoimidazole ribonucleotide[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
Pathways
- PWY-6123, inosine-5'-phosphate biosynthesis I: PWY-6123
- 5 reactions found over 6 reactions in the full pathway
- PWY-7234, inosine-5'-phosphate biosynthesis III: PWY-7234
- 4 reactions found over 6 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
External links