Difference between revisions of "MAP-Kinase-L-Phosphotyrosine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DISULFOXRED-RXN DISULFOXRED-RXN] == * direction: ** REVERSIBLE * common name: ** dsba_oxidoreductas...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] == * smiles: ** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DISULFOXRED-RXN DISULFOXRED-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-28 CPD66-28] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
 
* common name:
 
* common name:
−
** dsba_oxidoreductase
+
** pregn-5-ene-3,20-dione
 +
* molecular weight:
 +
** 314.467   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Protein-Red-Disulfides]][c] '''<=>''' 1 [[Protein-Ox-Disulfides]][c]
+
* [[RXN66-353]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a protein with reduced sulfide groups[c] '''<=>''' 1 a protein with oxidized disulfide bonds[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_9683]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_6764]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_16604]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_4244]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=dsba_oxidoreductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=150901 150901]
−
{{#set: gene associated=Tiso_gene_9683|Tiso_gene_6764|Tiso_gene_16604|Tiso_gene_4244}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.546029.html 546029]
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction tool=pantograph}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63837 63837]
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: smiles=CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=pregn-5-ene-3,20-dione}}
−
{{#set: reconstruction source=in-silico_annotation}}
+
{{#set: molecular weight=314.467    }}
 +
{{#set: produced by=RXN66-353}}

Revision as of 18:34, 18 March 2018

Metabolite CPD66-28

  • smiles:
    • CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=MNRHZPCIEGLWGK-LEKSSAKUSA-N
  • common name:
    • pregn-5-ene-3,20-dione
  • molecular weight:
    • 314.467
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=MAP-Kinase-L-Phosphotyrosine&oldid=25369"