Difference between revisions of "HBCO"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_9885 == * left end position: ** 3882 * transcription direction: ** POSITIVE * right end position: ** 5301 * centisome position: ** 43.14292...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2C...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_9885 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-709 CPD-709] ==
* left end position:
+
* smiles:
** 3882
+
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
* transcription direction:
+
* inchi key:
** POSITIVE
+
** InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
* right end position:
+
* common name:
** 5301
+
** (5α)-campestan-3-one
* centisome position:
+
* molecular weight:
** 43.14292    
+
** 400.687    
 
* Synonym(s):
 
* Synonym(s):
 +
** methylcholestanone
 +
** (24R)-24-methyl-5α-cholestan-3-one
 +
** 3-dehydro-campestanol
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[2.3.1.41-RXN]]
+
* [[RXN-4230]]
** experimental_annotation
+
== Reaction(s) known to produce the compound ==
***automated-name-match
+
* [[RXN-711]]
* [[3-OXOACYL-ACP-REDUCT-RXN]]
+
== Reaction(s) of unknown directionality ==
** experimental_annotation
+
***ec-number
+
* [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
+
** experimental_annotation
+
***automated-name-match
+
* [[RXN-10060]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-10655]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-10659]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-11476]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-11480]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-12994]]
+
** experimental_annotation
+
***automated-name-match
+
* [[RXN-13008]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-13443]]
+
** experimental_annotation
+
***automated-name-match
+
* [[RXN-16616]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16622]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16626]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-16630]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9514]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9518]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9524]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9528]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9532]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9536]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9540]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9552]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9556]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN-9633]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN0-2142]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-157]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-349]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-469]]
+
** experimental_annotation
+
***ec-number
+
* [[RXN1G-508]]
+
** experimental_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7388]]
+
* [[PWY-5367]]
+
* [[PWY-5973]]
+
* [[PWY-5971]]
+
* [[PWY-5499]]
+
* [[PWY0-862]]
+
* [[PWY-7053]]
+
* [[PWY-6113]]
+
* [[PWY-7619]]
+
* [[PWY-6282]]
+
* [[PWY-5994]]
+
* [[PWY3O-355]]
+
* [[PWY-7724]]
+
* [[PWY-7727]]
+
* [[FASYN-ELONG-PWY]]
+
* [[PWY-6519]]
+
* [[PWY-7602]]
+
* [[PWY-7606]]
+
* [[PWY-5989]]
+
* [[PWYG-321]]
+
* [[PWY-7663]]
+
* [[PWY-7664]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=3882}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16061343 16061343]
{{#set: right end position=5301}}
+
* CHEBI:
{{#set: centisome position=43.14292   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18533 18533]
{{#set: reaction associated=2.3.1.41-RXN|3-OXOACYL-ACP-REDUCT-RXN|PYRIDOXAL-4-DEHYDROGENASE-RXN|RXN-10060|RXN-10655|RXN-10659|RXN-11476|RXN-11480|RXN-12994|RXN-13008|RXN-13443|RXN-16616|RXN-16622|RXN-16626|RXN-16630|RXN-9514|RXN-9518|RXN-9524|RXN-9528|RXN-9532|RXN-9536|RXN-9540|RXN-9552|RXN-9556|RXN-9633|RXN0-2142|RXN1G-157|RXN1G-349|RXN1G-469|RXN1G-508}}
+
* LIGAND-CPD:
{{#set: pathway associated=PWY-7388|PWY-5367|PWY-5973|PWY-5971|PWY-5499|PWY0-862|PWY-7053|PWY-6113|PWY-7619|PWY-6282|PWY-5994|PWY3O-355|PWY-7724|PWY-7727|FASYN-ELONG-PWY|PWY-6519|PWY-7602|PWY-7606|PWY-5989|PWYG-321|PWY-7663|PWY-7664}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15786 C15786]
 +
* HMDB : HMDB12116
 +
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N}}
 +
{{#set: common name=(5α)-campestan-3-one}}
 +
{{#set: molecular weight=400.687   }}
 +
{{#set: common name=methylcholestanone|(24R)-24-methyl-5α-cholestan-3-one|3-dehydro-campestanol}}
 +
{{#set: consumed by=RXN-4230}}
 +
{{#set: produced by=RXN-711}}

Revision as of 18:39, 18 March 2018

Metabolite CPD-709

  • smiles:
    • CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=DDJMOMHMVFXEQF-JBQSTXLYSA-N
  • common name:
    • (5α)-campestan-3-one
  • molecular weight:
    • 400.687
  • Synonym(s):
    • methylcholestanone
    • (24R)-24-methyl-5α-cholestan-3-one
    • 3-dehydro-campestanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.