Difference between revisions of "Tiso gene 9068"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14193 RXN-14193] == * direction: ** REVERSIBLE * Synonym(s): == Reaction Formula == * With ide...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-718 CPD-718] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14193 RXN-14193] ==
−
* smiles:
+
* direction:
−
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N
+
−
* common name:
+
−
** 3-dehydroteasterone
+
−
* molecular weight:
+
−
** 446.669   
+
 
* Synonym(s):
 
* Synonym(s):
−
** dehydroteasterone
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-717]]
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[BUTYRYL-COA]][c] '''+''' 1.0 [[FAD]][c] '''<=>''' 1.0 [[FADH2]][c] '''+''' 1.0 [[CROTONYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H+[c] '''+''' 1.0 butanoyl-CoA[c] '''+''' 1.0 FAD[c] '''<=>''' 1.0 FADH2[c] '''+''' 1.0 crotonyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_18566]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_8272]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_6475]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
* [[Tiso_gene_14511]]
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14353979 14353979]
+
{{#set: gene associated=Tiso_gene_18566|Tiso_gene_8272|Tiso_gene_6475|Tiso_gene_14511}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=20000 20000]
+
{{#set: reconstruction category=orthology}}
−
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15792 C15792]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(=O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=SVBMASFUJDIDJC-XFJIFGBKSA-N}}
+
−
{{#set: common name=3-dehydroteasterone}}
+
−
{{#set: molecular weight=446.669    }}
+
−
{{#set: common name=dehydroteasterone}}
+
−
{{#set: produced by=RXN-717}}
+

Revision as of 18:40, 18 March 2018

Reaction RXN-14193

  • direction:
    • REVERSIBLE
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[c] + 1.0 butanoyl-CoA[c] + 1.0 FAD[c] <=> 1.0 FADH2[c] + 1.0 crotonyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9068&oldid=26082"