Difference between revisions of "CPD-9446"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] == * smiles: ** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4)))...")
(Created page with "Category:Gene == Gene Tiso_gene_2614 == * left end position: ** 18398 * transcription direction: ** NEGATIVE * right end position: ** 20278 * centisome position: ** 86.036...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-132 CPD1F-132] ==
+
== Gene Tiso_gene_2614 ==
* smiles:
+
* left end position:
** C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))
+
** 18398
* inchi key:
+
* transcription direction:
** InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M
+
** NEGATIVE
* common name:
+
* right end position:
** ent-kaur-16-en-19-oate
+
** 20278
* molecular weight:
+
* centisome position:
** 301.448    
+
** 86.036285    
 
* Synonym(s):
 
* Synonym(s):
** ent-kaurenoate
 
** ent-kaurenoic acid
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[1.14.13.79-RXN]]
+
* [[THRESYN-RXN]]
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
* [[RXN-7580]]
+
***ec-number
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[HOMOSER-THRESYN-PWY]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104130004
+
{{#set: left end position=18398}}
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200785 25200785]
+
{{#set: right end position=20278}}
* CHEBI:
+
{{#set: centisome position=86.036285   }}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57297 57297]
+
{{#set: reaction associated=THRESYN-RXN}}
* LIGAND-CPD:
+
{{#set: pathway associated=HOMOSER-THRESYN-PWY}}
** [http://www.genome.jp/dbget-bin/www_bget?C11874 C11874]
+
{{#set: smiles=C=C1(C4(CC3(C1)(CC[CH]2(C(C)(C([O-])=O)CCCC(C)2[CH]3CC4))))}}
+
{{#set: inchi key=InChIKey=NIKHGUQULKYIGE-OTCXFQBHSA-M}}
+
{{#set: common name=ent-kaur-16-en-19-oate}}
+
{{#set: molecular weight=301.448   }}
+
{{#set: common name=ent-kaurenoate|ent-kaurenoic acid}}
+
{{#set: consumed by=1.14.13.79-RXN}}
+
{{#set: produced by=RXN-7580}}
+

Revision as of 18:45, 18 March 2018

Gene Tiso_gene_2614

  • left end position:
    • 18398
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 20278
  • centisome position:
    • 86.036285
  • Synonym(s):

Reactions associated

Pathways associated

External links