Difference between revisions of "Tiso gene 20236"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=mitochondrial-intermediate-protein mitochondrial-intermediate-protein] == * common name: ** mit...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == * smiles: ** C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1137 CPD-1137] == |
+ | * smiles: | ||
+ | ** C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O | ||
+ | * inchi key: | ||
+ | ** InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I | ||
* common name: | * common name: | ||
− | ** | + | ** itaconyl-CoA |
+ | * molecular weight: | ||
+ | ** 874.579 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8988]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00531 C00531] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57381 57381] | ||
+ | * METABOLIGHTS : MTBLC57381 | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266606 45266606] | ||
+ | * HMDB : HMDB03377 | ||
+ | {{#set: smiles=C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I}} | ||
+ | {{#set: common name=itaconyl-CoA}} | ||
+ | {{#set: molecular weight=874.579 }} | ||
+ | {{#set: produced by=RXN-8988}} |
Revision as of 18:45, 18 March 2018
Contents
Metabolite CPD-1137
- smiles:
- C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O
- inchi key:
- InChIKey=NFVGYLGSSJPRKW-CITAKDKDSA-I
- common name:
- itaconyl-CoA
- molecular weight:
- 874.579
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.