Difference between revisions of "Tiso gene 608"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ALA-tRNAs Charged-ALA-tRNAs] == * common name: ** an L-alanyl-[tRNAala] * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == * smiles: ** C(CCC(=O)[O-])CC1(CCSS1) * inchi key: ** InChIKey=AGBQ...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOIC-ACID LIPOIC-ACID] == |
+ | * smiles: | ||
+ | ** C(CCC(=O)[O-])CC1(CCSS1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** (R)-lipoate |
+ | * molecular weight: | ||
+ | ** 205.309 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** α-liponic acid | ||
+ | ** 5-(1,2-dithiolan-3-yl)-pentanoate | ||
+ | ** lipoic acid | ||
+ | ** 6,8-thioctic acid | ||
+ | ** 6,8-thioctate | ||
+ | ** DL-thioctic acid | ||
+ | ** DL-thioctate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17127]] | ||
+ | * [[RXN0-1141]] | ||
+ | * [[RXN-8654]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 62-46-4 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549144 1549144] | ||
+ | * HMDB : HMDB01451 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16241 C16241] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.841.html 841] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83088 83088] | ||
+ | * METABOLIGHTS : MTBLC30313 | ||
+ | {{#set: smiles=C(CCC(=O)[O-])CC1(CCSS1)}} | ||
+ | {{#set: inchi key=InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M}} | ||
+ | {{#set: common name=(R)-lipoate}} | ||
+ | {{#set: molecular weight=205.309 }} | ||
+ | {{#set: common name=α-liponic acid|5-(1,2-dithiolan-3-yl)-pentanoate|lipoic acid|6,8-thioctic acid|6,8-thioctate|DL-thioctic acid|DL-thioctate}} | ||
+ | {{#set: consumed by=RXN-17127|RXN0-1141|RXN-8654}} |
Revision as of 19:48, 18 March 2018
Contents
Metabolite LIPOIC-ACID
- smiles:
- C(CCC(=O)[O-])CC1(CCSS1)
- inchi key:
- InChIKey=AGBQKNBQESQNJD-SSDOTTSWSA-M
- common name:
- (R)-lipoate
- molecular weight:
- 205.309
- Synonym(s):
- α-liponic acid
- 5-(1,2-dithiolan-3-yl)-pentanoate
- lipoic acid
- 6,8-thioctic acid
- 6,8-thioctate
- DL-thioctic acid
- DL-thioctate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 62-46-4
- PUBCHEM:
- HMDB : HMDB01451
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC30313
"C(CCC(=O)[O-])CC1(CCSS1)" cannot be used as a page name in this wiki.